C26H23FN2S — CID 164526564
4-fluoro-2-isothiocyanato-5-[2-[2-methyl-4-(4-pentylphenyl)phenyl]ethynyl]pyridine (PubChem CID 164526564) has the molecular formula C26H23FN2S and a molecular weight of 414.55 g/mol. Its IUPAC name is 4-fluoro-2-isothiocyanato-5-[2-[2-methyl-4-(4-pentylphenyl)phenyl]ethynyl]pyridine.
| Compound Name | 4-fluoro-2-isothiocyanato-5-[2-[2-methyl-4-(4-pentylphenyl)phenyl]ethynyl]pyridine |
|---|---|
| PubChem CID | 164526564 |
| Molecular Formula | C26H23FN2S |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-fluoro-2-isothiocyanato-5-[2-[2-methyl-4-(4-pentylphenyl)phenyl]ethynyl]pyridine |
| SMILES | CCCCCc1ccc(-c2ccc(C#Cc3cnc(N=C=S)cc3F)c(C)c2)cc1 |
| InChI | InChI=1S/C26H23FN2S/c1-3-4-5-6-20-7-9-22(10-8-20)23-13-11-21(19(2)15-23)12-14-24-17-28-26(29-18-30)16-25(24)27/h7-11,13,15-17H,3-6H2,1-2H3 |
| InChIKey | UFAATFTWTVCCIV-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|