C19H25ClN4OS — CID 164529489
2-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]-1-[4-(4-chlorophenyl)piperazin-1-yl]ethanone (PubChem CID 164529489) has the molecular formula C19H25ClN4OS and a molecular weight of 392.96 g/mol. Its IUPAC name is 2-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]-1-[4-(4-chlorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]-1-[4-(4-chlorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 164529489 |
| Molecular Formula | C19H25ClN4OS |
| Molecular Weight | 392.96 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-[[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]sulfanyl]-1-[4-(4-chlorophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CSC1=N[C@H]2CCCC[C@@H]2N1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H25ClN4OS/c20-14-5-7-15(8-6-14)23-9-11-24(12-10-23)18(25)13-26-19-21-16-3-1-2-4-17(16)22-19/h5-8,16-17H,1-4,9-13H2,(H,21,22)/t16-,17-/m0/s1 |
| InChIKey | GIPQSMWUAKNZLK-IRXDYDNUSA-N |
| XLogP | 2.99 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.96 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |