C27H39N3O2Si — CID 164531229
N-(5,5-dimethyl-6,8-dihydroimidazo[2,1-c][1,4]oxazin-2-yl)-4-methyl-3-[2-tri(propan-2-yl)silylethynyl]benzamide (PubChem CID 164531229) has the molecular formula C27H39N3O2Si and a molecular weight of 465.71 g/mol. Its IUPAC name is N-(5,5-dimethyl-6,8-dihydroimidazo[2,1-c][1,4]oxazin-2-yl)-4-methyl-3-[2-tri(propan-2-yl)silylethynyl]benzamide.
| Compound Name | N-(5,5-dimethyl-6,8-dihydroimidazo[2,1-c][1,4]oxazin-2-yl)-4-methyl-3-[2-tri(propan-2-yl)silylethynyl]benzamide |
|---|---|
| PubChem CID | 164531229 |
| Molecular Formula | C27H39N3O2Si |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | N-(5,5-dimethyl-6,8-dihydroimidazo[2,1-c][1,4]oxazin-2-yl)-4-methyl-3-[2-tri(propan-2-yl)silylethynyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cn3c(n2)COCC3(C)C)cc1C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H39N3O2Si/c1-18(2)33(19(3)4,20(5)6)13-12-22-14-23(11-10-21(22)7)26(31)29-24-15-30-25(28-24)16-32-17-27(30,8)9/h10-11,14-15,18-20H,16-17H2,1-9H3,(H,29,31) |
| InChIKey | DNRQHDJEJOJPBO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|