C14H23NO — CID 164543502
1-[(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidin-3-ol (PubChem CID 164543502) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-[(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidin-3-ol.
| Compound Name | 1-[(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidin-3-ol |
|---|---|
| PubChem CID | 164543502 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-[(2E)-4-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]piperidin-3-ol |
| SMILES | C=C(C)/C=C(\C=C/C)CN1CCCC(O)C1 |
| InChI | InChI=1S/C14H23NO/c1-4-6-13(9-12(2)3)10-15-8-5-7-14(16)11-15/h4,6,9,14,16H,2,5,7-8,10-11H2,1,3H3/b6-4-,13-9+ |
| InChIKey | CJXMHIAVAGCXFF-WZSXDBPKSA-N |
| XLogP | 2.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|