C23H27BrClN5O6 — CID 164545499
tert-butyl 3-[3-bromo-4-[(4-chloro-6-morpholin-4-ylpyrimidin-5-yl)methoxy]-5-nitrophenyl]azetidine-1-carboxylate (PubChem CID 164545499) has the molecular formula C23H27BrClN5O6 and a molecular weight of 584.86 g/mol. Its IUPAC name is tert-butyl 3-[3-bromo-4-[(4-chloro-6-morpholin-4-ylpyrimidin-5-yl)methoxy]-5-nitrophenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-bromo-4-[(4-chloro-6-morpholin-4-ylpyrimidin-5-yl)methoxy]-5-nitrophenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 164545499 |
| Molecular Formula | C23H27BrClN5O6 |
| Molecular Weight | 584.86 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | tert-butyl 3-[3-bromo-4-[(4-chloro-6-morpholin-4-ylpyrimidin-5-yl)methoxy]-5-nitrophenyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2cc(Br)c(OCc3c(Cl)ncnc3N3CCOCC3)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C23H27BrClN5O6/c1-23(2,3)36-22(31)29-10-15(11-29)14-8-17(24)19(18(9-14)30(32)33)35-12-16-20(25)26-13-27-21(16)28-4-6-34-7-5-28/h8-9,13,15H,4-7,10-12H2,1-3H3 |
| InChIKey | CWGGNHAVWMWVEI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 120.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.86 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|