C26H34ClN3O4 — CID 165115248
tert-butyl 3-[3-amino-4-[[2-chloro-4-(oxan-4-yl)-3-pyridinyl]methoxy]-5-methylphenyl]azetidine-1-carboxylate (PubChem CID 165115248) has the molecular formula C26H34ClN3O4 and a molecular weight of 488.03 g/mol. Its IUPAC name is tert-butyl 3-[3-amino-4-[[2-chloro-4-(oxan-4-yl)-3-pyridinyl]methoxy]-5-methylphenyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-amino-4-[[2-chloro-4-(oxan-4-yl)-3-pyridinyl]methoxy]-5-methylphenyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 165115248 |
| Molecular Formula | C26H34ClN3O4 |
| Molecular Weight | 488.03 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | tert-butyl 3-[3-amino-4-[[2-chloro-4-(oxan-4-yl)-3-pyridinyl]methoxy]-5-methylphenyl]azetidine-1-carboxylate |
| SMILES | Cc1cc(C2CN(C(=O)OC(C)(C)C)C2)cc(N)c1OCc1c(C2CCOCC2)ccnc1Cl |
| InChI | InChI=1S/C26H34ClN3O4/c1-16-11-18(19-13-30(14-19)25(31)34-26(2,3)4)12-22(28)23(16)33-15-21-20(5-8-29-24(21)27)17-6-9-32-10-7-17/h5,8,11-12,17,19H,6-7,9-10,13-15,28H2,1-4H3 |
| InChIKey | NSZFACZGJMSPCT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.03 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|