C21H30ClNO3 — CID 142523997
tert-butyl 5-chloro-3-methyl-7-(oxan-4-yl)indole-1-carboxylate;ethane (PubChem CID 142523997) has the molecular formula C21H30ClNO3 and a molecular weight of 379.93 g/mol. Its IUPAC name is tert-butyl 5-chloro-3-methyl-7-(oxan-4-yl)indole-1-carboxylate;ethane.
| Compound Name | tert-butyl 5-chloro-3-methyl-7-(oxan-4-yl)indole-1-carboxylate;ethane |
|---|---|
| PubChem CID | 142523997 |
| Molecular Formula | C21H30ClNO3 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | tert-butyl 5-chloro-3-methyl-7-(oxan-4-yl)indole-1-carboxylate;ethane |
| SMILES | CC.Cc1cn(C(=O)OC(C)(C)C)c2c(C3CCOCC3)cc(Cl)cc12 |
| InChI | InChI=1S/C19H24ClNO3.C2H6/c1-12-11-21(18(22)24-19(2,3)4)17-15(12)9-14(20)10-16(17)13-5-7-23-8-6-13;1-2/h9-11,13H,5-8H2,1-4H3;1-2H3 |
| InChIKey | KQFUZSOCXDMUIJ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |