C18H22ClN3O3 — CID 87606195
tert-butyl 7-chloro-4-[cyclopropyl(methyl)carbamoyl]-3-methylpyrrolo[2,3-c]pyridine-1-carboxylate (PubChem CID 87606195) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is tert-butyl 7-chloro-4-[cyclopropyl(methyl)carbamoyl]-3-methylpyrrolo[2,3-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl 7-chloro-4-[cyclopropyl(methyl)carbamoyl]-3-methylpyrrolo[2,3-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 87606195 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | tert-butyl 7-chloro-4-[cyclopropyl(methyl)carbamoyl]-3-methylpyrrolo[2,3-c]pyridine-1-carboxylate |
| SMILES | Cc1cn(C(=O)OC(C)(C)C)c2c(Cl)ncc(C(=O)N(C)C3CC3)c12 |
| InChI | InChI=1S/C18H22ClN3O3/c1-10-9-22(17(24)25-18(2,3)4)14-13(10)12(8-20-15(14)19)16(23)21(5)11-6-7-11/h8-9,11H,6-7H2,1-5H3 |
| InChIKey | QFRIXPACAHQDNA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|