C20H26BrNO4 — CID 155425802
tert-butyl 2-[5-bromo-2-(oxan-4-yl)phenyl]-4-oxopyrrolidine-1-carboxylate (PubChem CID 155425802) has the molecular formula C20H26BrNO4 and a molecular weight of 424.34 g/mol. Its IUPAC name is tert-butyl 2-[5-bromo-2-(oxan-4-yl)phenyl]-4-oxopyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[5-bromo-2-(oxan-4-yl)phenyl]-4-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155425802 |
| Molecular Formula | C20H26BrNO4 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | tert-butyl 2-[5-bromo-2-(oxan-4-yl)phenyl]-4-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC1c1cc(Br)ccc1C1CCOCC1 |
| InChI | InChI=1S/C20H26BrNO4/c1-20(2,3)26-19(24)22-12-15(23)11-18(22)17-10-14(21)4-5-16(17)13-6-8-25-9-7-13/h4-5,10,13,18H,6-9,11-12H2,1-3H3 |
| InChIKey | VBJFRNXNNOJYQP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |