C13H16O2 — CID 164546627
spiro[4.5]deca-1,3-dien-4-yl prop-2-enoate (PubChem CID 164546627) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is spiro[4.5]deca-1,3-dien-4-yl prop-2-enoate.
| Compound Name | spiro[4.5]deca-1,3-dien-4-yl prop-2-enoate |
|---|---|
| PubChem CID | 164546627 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | spiro[4.5]deca-1,3-dien-4-yl prop-2-enoate |
| SMILES | C=CC(=O)OC1=CC=CC12CCCCC2 |
| InChI | InChI=1S/C13H16O2/c1-2-12(14)15-11-7-6-10-13(11)8-4-3-5-9-13/h2,6-7,10H,1,3-5,8-9H2 |
| InChIKey | YUBXOQZLAHJRRE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|