C14H16O2 — CID 164546880
spiro[4.6]undeca-1,3,10-trien-4-yl prop-2-enoate (PubChem CID 164546880) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is spiro[4.6]undeca-1,3,10-trien-4-yl prop-2-enoate.
| Compound Name | spiro[4.6]undeca-1,3,10-trien-4-yl prop-2-enoate |
|---|---|
| PubChem CID | 164546880 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | spiro[4.6]undeca-1,3,10-trien-4-yl prop-2-enoate |
| SMILES | C=CC(=O)OC1=CC=CC12C=CCCCC2 |
| InChI | InChI=1S/C14H16O2/c1-2-13(15)16-12-8-7-11-14(12)9-5-3-4-6-10-14/h2,5,7-9,11H,1,3-4,6,10H2 |
| InChIKey | YHQYXGXEOPOKAR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|