C15H18O2 — CID 164546829
spiro[5.6]dodeca-2,4,11-trien-5-yl prop-2-enoate (PubChem CID 164546829) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is spiro[5.6]dodeca-2,4,11-trien-5-yl prop-2-enoate.
| Compound Name | spiro[5.6]dodeca-2,4,11-trien-5-yl prop-2-enoate |
|---|---|
| PubChem CID | 164546829 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | spiro[5.6]dodeca-2,4,11-trien-5-yl prop-2-enoate |
| SMILES | C=CC(=O)OC1=CC=CCC12C=CCCCC2 |
| InChI | InChI=1S/C15H18O2/c1-2-14(16)17-13-9-5-8-12-15(13)10-6-3-4-7-11-15/h2,5-6,8-10H,1,3-4,7,11-12H2 |
| InChIKey | JTKRIECDMXDEPG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|