C9H11NO5 — CID 164547889
1,4,13-trioxa-7-azadispiro[4.0.56.25]tridecane-2,3-dione (PubChem CID 164547889) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is 1,4,13-trioxa-7-azadispiro[4.0.56.25]tridecane-2,3-dione.
| Compound Name | 1,4,13-trioxa-7-azadispiro[4.0.56.25]tridecane-2,3-dione |
|---|---|
| PubChem CID | 164547889 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 1,4,13-trioxa-7-azadispiro[4.0.56.25]tridecane-2,3-dione |
| SMILES | O=C1OC2(OCC23CCCCN3)OC1=O |
| InChI | InChI=1S/C9H11NO5/c11-6-7(12)15-9(14-6)8(5-13-9)3-1-2-4-10-8/h10H,1-5H2 |
| InChIKey | FEUYOCDMVIRGHX-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|