C47H86N4O8S2 — CID 164548479
[(Z)-non-2-enyl] 8-[2-[2-[2-(4-methylpiperazin-1-yl)ethylcarbamoyloxy]ethyldisulfanyl]ethoxycarbonyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate (PubChem CID 164548479) has the molecular formula C47H86N4O8S2 and a molecular weight of 899.36 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 8-[2-[2-[2-(4-methylpiperazin-1-yl)ethylcarbamoyloxy]ethyldisulfanyl]ethoxycarbonyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate.
| Compound Name | [(Z)-non-2-enyl] 8-[2-[2-[2-(4-methylpiperazin-1-yl)ethylcarbamoyloxy]ethyldisulfanyl]ethoxycarbonyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate |
|---|---|
| PubChem CID | 164548479 |
| Molecular Formula | C47H86N4O8S2 |
| Molecular Weight | 899.36 g/mol |
| Exact Mass | 898.59 |
| IUPAC Name | [(Z)-non-2-enyl] 8-[2-[2-[2-(4-methylpiperazin-1-yl)ethylcarbamoyloxy]ethyldisulfanyl]ethoxycarbonyl-[8-[(Z)-non-2-enoxy]-8-oxooctyl]amino]octanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCN(CCCCCCCC(=O)OC/C=C\CCCCCC)C(=O)OCCSSCCOC(=O)NCCN1CCN(C)CC1 |
| InChI | InChI=1S/C47H86N4O8S2/c1-4-6-8-10-12-20-26-38-56-44(52)28-22-16-14-18-24-31-51(32-25-19-15-17-23-29-45(53)57-39-27-21-13-11-9-7-5-2)47(55)59-41-43-61-60-42-40-58-46(54)48-30-33-50-36-34-49(3)35-37-50/h20-21,26-27H,4-19,22-25,28-43H2,1-3H3,(H,48,54)/b26-20-,27-21- |
| InChIKey | ZFMFNOSRUSKTIC-AQPNWFMJSA-N |
| XLogP | 10.60 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.36 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|