C14H16F4N2O2 — CID 164549724
methyl 2-[5-amino-2-[(3R)-3-fluoropyrrolidin-1-yl]-4-(trifluoromethyl)phenyl]acetate (PubChem CID 164549724) has the molecular formula C14H16F4N2O2 and a molecular weight of 320.29 g/mol. Its IUPAC name is methyl 2-[5-amino-2-[(3R)-3-fluoropyrrolidin-1-yl]-4-(trifluoromethyl)phenyl]acetate.
| Compound Name | methyl 2-[5-amino-2-[(3R)-3-fluoropyrrolidin-1-yl]-4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 164549724 |
| Molecular Formula | C14H16F4N2O2 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | methyl 2-[5-amino-2-[(3R)-3-fluoropyrrolidin-1-yl]-4-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)Cc1cc(N)c(C(F)(F)F)cc1N1CC[C@@H](F)C1 |
| InChI | InChI=1S/C14H16F4N2O2/c1-22-13(21)5-8-4-11(19)10(14(16,17)18)6-12(8)20-3-2-9(15)7-20/h4,6,9H,2-3,5,7,19H2,1H3/t9-/m1/s1 |
| InChIKey | TYEMJCRXGDVIQH-SECBINFHSA-N |
| XLogP | 2.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|