C17H17ClF3NO2S — CID 164554077
4-chloro-3-(methyl-methylidene-oxo-λ6-sulfanyl)-N-phenylbenzamide;1,1,1-trifluoroethane (PubChem CID 164554077) has the molecular formula C17H17ClF3NO2S and a molecular weight of 391.84 g/mol. Its IUPAC name is 4-chloro-3-(methyl-methylidene-oxo-λ6-sulfanyl)-N-phenylbenzamide;1,1,1-trifluoroethane.
| Compound Name | 4-chloro-3-(methyl-methylidene-oxo-λ6-sulfanyl)-N-phenylbenzamide;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 164554077 |
| Molecular Formula | C17H17ClF3NO2S |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 4-chloro-3-(methyl-methylidene-oxo-λ6-sulfanyl)-N-phenylbenzamide;1,1,1-trifluoroethane |
| SMILES | C=S(C)(=O)c1cc(C(=O)Nc2ccccc2)ccc1Cl.CC(F)(F)F |
| InChI | InChI=1S/C15H14ClNO2S.C2H3F3/c1-20(2,19)14-10-11(8-9-13(14)16)15(18)17-12-6-4-3-5-7-12;1-2(3,4)5/h3-10H,1H2,2H3,(H,17,18);1H3 |
| InChIKey | QRIWLYUWDDZFAC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|