About 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine
4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine (PubChem CID 164558917) has the molecular formula C13H17F3N2O
and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine.
Molecular Properties
| Compound Name | 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine |
| PubChem CID | 164558917 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine |
| SMILES | CN1CCCC1.Nc1ccc(C=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H6F3NO.C5H11N/c9-8(10,11)7-3-6(12)2-1-5(7)4-13;1-6-4-2-3-5-6/h1-4H,12H2;2-5H2,1H3 |
| InChIKey | UJTGXTRGANUSQX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine?
The IUPAC name of 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine (CID 164558917) is 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine.
What is the SMILES notation for 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine?
The canonical SMILES for 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine is CN1CCCC1.Nc1ccc(C=O)c(C(F)(F)F)c1.
What is the InChIKey of 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine?
The InChIKey is UJTGXTRGANUSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO.C5H11N/c9-8(10,11)7-3-6(12)2-1-5(7)4-13;1-6-4-2-3-5-6/h1-4H,12H2;2-5H2,1H3.
What are the key properties of 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine?
4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine has a molecular weight of 274.29 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(trifluoromethyl)benzaldehyde;1-methylpyrrolidine is sourced from PubChem (CID 164558917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).