C13H12F5NO — CID 162393585
4-(4,4-difluoropiperidin-1-yl)-2-(trifluoromethyl)benzaldehyde (PubChem CID 162393585) has the molecular formula C13H12F5NO and a molecular weight of 293.23 g/mol. Its IUPAC name is 4-(4,4-difluoropiperidin-1-yl)-2-(trifluoromethyl)benzaldehyde.
| Compound Name | 4-(4,4-difluoropiperidin-1-yl)-2-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 162393585 |
| Molecular Formula | C13H12F5NO |
| Molecular Weight | 293.23 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-(4,4-difluoropiperidin-1-yl)-2-(trifluoromethyl)benzaldehyde |
| SMILES | O=Cc1ccc(N2CCC(F)(F)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H12F5NO/c14-12(15)3-5-19(6-4-12)10-2-1-9(8-20)11(7-10)13(16,17)18/h1-2,7-8H,3-6H2 |
| InChIKey | KRARDDXFEIMOSK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|