C11H13ClN6O — CID 164560301
5-[(E)-(1-amino-3-chloropyrazin-2-ylidene)methoxy]-3-N-methylpyridine-2,3-diamine (PubChem CID 164560301) has the molecular formula C11H13ClN6O and a molecular weight of 280.72 g/mol. Its IUPAC name is 5-[(E)-(1-amino-3-chloropyrazin-2-ylidene)methoxy]-3-N-methylpyridine-2,3-diamine.
| Compound Name | 5-[(E)-(1-amino-3-chloropyrazin-2-ylidene)methoxy]-3-N-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 164560301 |
| Molecular Formula | C11H13ClN6O |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 5-[(E)-(1-amino-3-chloropyrazin-2-ylidene)methoxy]-3-N-methylpyridine-2,3-diamine |
| SMILES | CNc1cc(O/C=C2\C(Cl)=NC=CN2N)cnc1N |
| InChI | InChI=1S/C11H13ClN6O/c1-15-8-4-7(5-17-11(8)13)19-6-9-10(12)16-2-3-18(9)14/h2-6,15H,14H2,1H3,(H2,13,17)/b9-6+ |
| InChIKey | KWVKWZAUSHFBBX-RMKNXTFCSA-N |
| XLogP | 1.22 |
| TPSA | 101.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|