C26H23N5O — CID 164561998
3-methylidene-1-[4-[4-[(6-methyl-3-pyridinyl)methyl]anilino]quinazolin-6-yl]pyrrolidin-2-one (PubChem CID 164561998) has the molecular formula C26H23N5O and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-methylidene-1-[4-[4-[(6-methyl-3-pyridinyl)methyl]anilino]quinazolin-6-yl]pyrrolidin-2-one.
| Compound Name | 3-methylidene-1-[4-[4-[(6-methyl-3-pyridinyl)methyl]anilino]quinazolin-6-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 164561998 |
| Molecular Formula | C26H23N5O |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 3-methylidene-1-[4-[4-[(6-methyl-3-pyridinyl)methyl]anilino]quinazolin-6-yl]pyrrolidin-2-one |
| SMILES | C=C1CCN(c2ccc3ncnc(Nc4ccc(Cc5ccc(C)nc5)cc4)c3c2)C1=O |
| InChI | InChI=1S/C26H23N5O/c1-17-11-12-31(26(17)32)22-9-10-24-23(14-22)25(29-16-28-24)30-21-7-5-19(6-8-21)13-20-4-3-18(2)27-15-20/h3-10,14-16H,1,11-13H2,2H3,(H,28,29,30) |
| InChIKey | NZGVAMANGSHXKY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|