About CID 164569148
CID 164569148 (PubChem CID 164569148) has the molecular formula C33H13B5ClN3O2
and a molecular weight of 573.00 g/mol.
Molecular Properties
| Compound Name | CID 164569148 |
| PubChem CID | 164569148 |
| Molecular Formula | C33H13B5ClN3O2 |
| Molecular Weight | 573.00 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3ccc4c(c3)oc3ccccc34)nc(-c3ccc4c(c3)oc3cc(Cl)ccc34)n2)c([B])c1[B] |
| InChI | InChI=1S/C33H13B5ClN3O2/c34-26-25(27(35)29(37)30(38)28(26)36)33-41-31(14-5-8-18-17-3-1-2-4-21(17)43-22(18)11-14)40-32(42-33)15-6-9-19-20-10-7-16(39)13-24(20)44-23(19)12-15/h1-13H |
| InChIKey | RRJBAVRZVWKBIW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 573.00 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 164569148 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164569148?
The IUPAC name of CID 164569148 (CID 164569148) is not available.
What is the SMILES notation for CID 164569148?
The canonical SMILES for CID 164569148 is [B]c1c([B])c([B])c(-c2nc(-c3ccc4c(c3)oc3ccccc34)nc(-c3ccc4c(c3)oc3cc(Cl)ccc34)n2)c([B])c1[B].
What is the InChIKey of CID 164569148?
The InChIKey is RRJBAVRZVWKBIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H13B5ClN3O2/c34-26-25(27(35)29(37)30(38)28(26)36)33-41-31(14-5-8-18-17-3-1-2-4-21(17)43-22(18)11-14)40-32(42-33)15-6-9-19-20-10-7-16(39)13-24(20)44-23(19)12-15/h1-13H.
What are the key properties of CID 164569148?
CID 164569148 has a molecular weight of 573.00 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164569148 is sourced from PubChem (CID 164569148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).