C17H25N5OS — CID 164571877
2-imino-3-(methylideneamino)-N-(3-piperidin-1-ylpropyl)-1,3-benzothiazole-6-carboxamide;molecular hydrogen (PubChem CID 164571877) has the molecular formula C17H25N5OS and a molecular weight of 347.49 g/mol. Its IUPAC name is 2-imino-3-(methylideneamino)-N-(3-piperidin-1-ylpropyl)-1,3-benzothiazole-6-carboxamide;molecular hydrogen.
| Compound Name | 2-imino-3-(methylideneamino)-N-(3-piperidin-1-ylpropyl)-1,3-benzothiazole-6-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 164571877 |
| Molecular Formula | C17H25N5OS |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-imino-3-(methylideneamino)-N-(3-piperidin-1-ylpropyl)-1,3-benzothiazole-6-carboxamide;molecular hydrogen |
| SMILES | [H]/N=c1\sc2cc(C(=O)NCCCN3CCCCC3)ccc2n1N=C.[H][H] |
| InChI | InChI=1S/C17H23N5OS.H2/c1-19-22-14-7-6-13(12-15(14)24-17(22)18)16(23)20-8-5-11-21-9-3-2-4-10-21;/h6-7,12,18H,1-5,8-11H2,(H,20,23);1H/b18-17-; |
| InChIKey | XUALTMBTUROZQJ-YBFBCAGJSA-N |
| XLogP | 2.50 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|