C26H38N4OS — CID 58538865
(2Z)-4-(cyclohexylmethyl)-2-ethylidene-3-imino-N-(3-piperidin-1-ylpropyl)-1,4-benzothiazine-6-carboxamide (PubChem CID 58538865) has the molecular formula C26H38N4OS and a molecular weight of 454.68 g/mol. Its IUPAC name is (2Z)-4-(cyclohexylmethyl)-2-ethylidene-3-imino-N-(3-piperidin-1-ylpropyl)-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-4-(cyclohexylmethyl)-2-ethylidene-3-imino-N-(3-piperidin-1-ylpropyl)-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 58538865 |
| Molecular Formula | C26H38N4OS |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (2Z)-4-(cyclohexylmethyl)-2-ethylidene-3-imino-N-(3-piperidin-1-ylpropyl)-1,4-benzothiazine-6-carboxamide |
| SMILES | [H]/N=C1C(=C\C)\Sc2ccc(C(=O)NCCCN3CCCCC3)cc2N\1CC1CCCCC1 |
| InChI | InChI=1S/C26H38N4OS/c1-2-23-25(27)30(19-20-10-5-3-6-11-20)22-18-21(12-13-24(22)32-23)26(31)28-14-9-17-29-15-7-4-8-16-29/h2,12-13,18,20,27H,3-11,14-17,19H2,1H3,(H,28,31)/b23-2-,27-25+ |
| InChIKey | JGTGDLPPNWPTOU-HQJXKRFQSA-N |
| XLogP | 5.67 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|