C17H24O6 — CID 164574422
methyl 2-[(1S,3R,5R,8aR)-5-(dihydroxymethyl)-3-hydroxy-5,8a-dimethyl-2-methylidene-8-oxo-1,3,4,4a-tetrahydronaphthalen-1-yl]acetate (PubChem CID 164574422) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is methyl 2-[(1S,3R,5R,8aR)-5-(dihydroxymethyl)-3-hydroxy-5,8a-dimethyl-2-methylidene-8-oxo-1,3,4,4a-tetrahydronaphthalen-1-yl]acetate.
| Compound Name | methyl 2-[(1S,3R,5R,8aR)-5-(dihydroxymethyl)-3-hydroxy-5,8a-dimethyl-2-methylidene-8-oxo-1,3,4,4a-tetrahydronaphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 164574422 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | methyl 2-[(1S,3R,5R,8aR)-5-(dihydroxymethyl)-3-hydroxy-5,8a-dimethyl-2-methylidene-8-oxo-1,3,4,4a-tetrahydronaphthalen-1-yl]acetate |
| SMILES | C=C1[C@H](O)CC2[C@](C)(C(O)O)C=CC(=O)[C@]2(C)[C@H]1CC(=O)OC |
| InChI | InChI=1S/C17H24O6/c1-9-10(7-14(20)23-4)17(3)12(8-11(9)18)16(2,15(21)22)6-5-13(17)19/h5-6,10-12,15,18,21-22H,1,7-8H2,2-4H3/t10-,11+,12?,16+,17+/m0/s1 |
| InChIKey | UKTYTBWGDVQAHX-XEYQQUIZSA-N |
| XLogP | 0.56 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|