C11H12N2OS — CID 164578687
O-methyl 3-ethylpyrazolo[1,5-a]pyridine-2-carbothioate (PubChem CID 164578687) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is O-methyl 3-ethylpyrazolo[1,5-a]pyridine-2-carbothioate.
| Compound Name | O-methyl 3-ethylpyrazolo[1,5-a]pyridine-2-carbothioate |
|---|---|
| PubChem CID | 164578687 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | O-methyl 3-ethylpyrazolo[1,5-a]pyridine-2-carbothioate |
| SMILES | CCc1c(C(=S)OC)nn2ccccc12 |
| InChI | InChI=1S/C11H12N2OS/c1-3-8-9-6-4-5-7-13(9)12-10(8)11(15)14-2/h4-7H,3H2,1-2H3 |
| InChIKey | AFKHDNVWWLGDAP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|