C27H30FN5O2 — CID 164578984
1-[[4-[6-amino-5-(4-amino-2-fluorophenyl)-3-pyridinyl]phenyl]methyl]-3-(oxan-4-ylmethyl)imidazolidin-2-one (PubChem CID 164578984) has the molecular formula C27H30FN5O2 and a molecular weight of 475.57 g/mol. Its IUPAC name is 1-[[4-[6-amino-5-(4-amino-2-fluorophenyl)-3-pyridinyl]phenyl]methyl]-3-(oxan-4-ylmethyl)imidazolidin-2-one.
| Compound Name | 1-[[4-[6-amino-5-(4-amino-2-fluorophenyl)-3-pyridinyl]phenyl]methyl]-3-(oxan-4-ylmethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 164578984 |
| Molecular Formula | C27H30FN5O2 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 1-[[4-[6-amino-5-(4-amino-2-fluorophenyl)-3-pyridinyl]phenyl]methyl]-3-(oxan-4-ylmethyl)imidazolidin-2-one |
| SMILES | Nc1ccc(-c2cc(-c3ccc(CN4CCN(CC5CCOCC5)C4=O)cc3)cnc2N)c(F)c1 |
| InChI | InChI=1S/C27H30FN5O2/c28-25-14-22(29)5-6-23(25)24-13-21(15-31-26(24)30)20-3-1-18(2-4-20)16-32-9-10-33(27(32)34)17-19-7-11-35-12-8-19/h1-6,13-15,19H,7-12,16-17,29H2,(H2,30,31) |
| InChIKey | OSWFZGCVQOSECE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|