C22H22FN3O4 — CID 129135660
5-[6-amino-5-(4-amino-2-fluorophenyl)-3-pyridinyl]-2-[[(2R)-1,4-dioxan-2-yl]methoxy]phenol (PubChem CID 129135660) has the molecular formula C22H22FN3O4 and a molecular weight of 411.43 g/mol. Its IUPAC name is 5-[6-amino-5-(4-amino-2-fluorophenyl)-3-pyridinyl]-2-[[(2R)-1,4-dioxan-2-yl]methoxy]phenol.
| Compound Name | 5-[6-amino-5-(4-amino-2-fluorophenyl)-3-pyridinyl]-2-[[(2R)-1,4-dioxan-2-yl]methoxy]phenol |
|---|---|
| PubChem CID | 129135660 |
| Molecular Formula | C22H22FN3O4 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 5-[6-amino-5-(4-amino-2-fluorophenyl)-3-pyridinyl]-2-[[(2R)-1,4-dioxan-2-yl]methoxy]phenol |
| SMILES | Nc1ccc(-c2cc(-c3ccc(OC[C@H]4COCCO4)c(O)c3)cnc2N)c(F)c1 |
| InChI | InChI=1S/C22H22FN3O4/c23-19-9-15(24)2-3-17(19)18-7-14(10-26-22(18)25)13-1-4-21(20(27)8-13)30-12-16-11-28-5-6-29-16/h1-4,7-10,16,27H,5-6,11-12,24H2,(H2,25,26)/t16-/m1/s1 |
| InChIKey | IPCMNXYVOXAKCO-MRXNPFEDSA-N |
| XLogP | 3.22 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|