C22H24FN3O4 — CID 129135751
5-[2-amino-3-(4-amino-2-fluorophenyl)-1,2-dihydropyridin-5-yl]-2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenol (PubChem CID 129135751) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is 5-[2-amino-3-(4-amino-2-fluorophenyl)-1,2-dihydropyridin-5-yl]-2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenol.
| Compound Name | 5-[2-amino-3-(4-amino-2-fluorophenyl)-1,2-dihydropyridin-5-yl]-2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenol |
|---|---|
| PubChem CID | 129135751 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 5-[2-amino-3-(4-amino-2-fluorophenyl)-1,2-dihydropyridin-5-yl]-2-[[(2S)-1,4-dioxan-2-yl]methoxy]phenol |
| SMILES | Nc1ccc(C2=CC(c3ccc(OC[C@@H]4COCCO4)c(O)c3)=CNC2N)c(F)c1 |
| InChI | InChI=1S/C22H24FN3O4/c23-19-9-15(24)2-3-17(19)18-7-14(10-26-22(18)25)13-1-4-21(20(27)8-13)30-12-16-11-28-5-6-29-16/h1-4,7-10,16,22,26-27H,5-6,11-12,24-25H2/t16-,22?/m0/s1 |
| InChIKey | VJRRJSPTDMLHME-CISYCMJJSA-N |
| XLogP | 2.22 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|