C19H26O3 — CID 164580112
(2E)-4-(2,4-dimethoxyphenyl)-2,4,7-trimethylocta-2,6-dienal (PubChem CID 164580112) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (2E)-4-(2,4-dimethoxyphenyl)-2,4,7-trimethylocta-2,6-dienal.
| Compound Name | (2E)-4-(2,4-dimethoxyphenyl)-2,4,7-trimethylocta-2,6-dienal |
|---|---|
| PubChem CID | 164580112 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (2E)-4-(2,4-dimethoxyphenyl)-2,4,7-trimethylocta-2,6-dienal |
| SMILES | COc1ccc(C(C)(/C=C(\C)C=O)CC=C(C)C)c(OC)c1 |
| InChI | InChI=1S/C19H26O3/c1-14(2)9-10-19(4,12-15(3)13-20)17-8-7-16(21-5)11-18(17)22-6/h7-9,11-13H,10H2,1-6H3/b15-12+ |
| InChIKey | WJBOULHRGQUQAQ-NTCAYCPXSA-N |
| XLogP | 4.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|