C16H26S — CID 164584813
2-[(2R,8R,8aS)-8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl]-2-methylthietane (PubChem CID 164584813) has the molecular formula C16H26S and a molecular weight of 250.45 g/mol. Its IUPAC name is 2-[(2R,8R,8aS)-8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl]-2-methylthietane.
| Compound Name | 2-[(2R,8R,8aS)-8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl]-2-methylthietane |
|---|---|
| PubChem CID | 164584813 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-[(2R,8R,8aS)-8,8a-dimethyl-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-yl]-2-methylthietane |
| SMILES | C[C@@H]1CCC=C2CC[C@@H](C3(C)CCS3)C[C@]21C |
| InChI | InChI=1S/C16H26S/c1-12-5-4-6-13-7-8-14(11-15(12,13)2)16(3)9-10-17-16/h6,12,14H,4-5,7-11H2,1-3H3/t12-,14-,15+,16?/m1/s1 |
| InChIKey | YCURAZWSGPFOOR-SLHHOWHOSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|