C11H24O5 — CID 164585428
3-butyl-5-(hydroxymethyl)-1,4-dioxane-2,6-diol;ethane (PubChem CID 164585428) has the molecular formula C11H24O5 and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-butyl-5-(hydroxymethyl)-1,4-dioxane-2,6-diol;ethane.
| Compound Name | 3-butyl-5-(hydroxymethyl)-1,4-dioxane-2,6-diol;ethane |
|---|---|
| PubChem CID | 164585428 |
| Molecular Formula | C11H24O5 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-butyl-5-(hydroxymethyl)-1,4-dioxane-2,6-diol;ethane |
| SMILES | CC.CCCCC1OC(CO)C(O)OC1O |
| InChI | InChI=1S/C9H18O5.C2H6/c1-2-3-4-6-8(11)14-9(12)7(5-10)13-6;1-2/h6-12H,2-5H2,1H3;1-2H3 |
| InChIKey | NQOSTSVMQOFARI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |