C7H11NO — CID 164585640
(1R,6R)-6-methyl-2-azabicyclo[2.2.1]heptan-3-one (PubChem CID 164585640) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is (1R,6R)-6-methyl-2-azabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1R,6R)-6-methyl-2-azabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 164585640 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | (1R,6R)-6-methyl-2-azabicyclo[2.2.1]heptan-3-one |
| SMILES | C[C@@H]1CC2C[C@H]1NC2=O |
| InChI | InChI=1S/C7H11NO/c1-4-2-5-3-6(4)8-7(5)9/h4-6H,2-3H2,1H3,(H,8,9)/t4-,5?,6-/m1/s1 |
| InChIKey | KOGBYHZOPFCFEA-SPWIIUKKSA-N |
| XLogP | 0.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |