C6H9NO2 — CID 13437990
5-methoxy-2-azabicyclo[2.2.0]hexan-3-one (PubChem CID 13437990) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 5-methoxy-2-azabicyclo[2.2.0]hexan-3-one.
| Compound Name | 5-methoxy-2-azabicyclo[2.2.0]hexan-3-one |
|---|---|
| PubChem CID | 13437990 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 5-methoxy-2-azabicyclo[2.2.0]hexan-3-one |
| SMILES | COC1CC2NC(=O)C21 |
| InChI | InChI=1S/C6H9NO2/c1-9-4-2-3-5(4)6(8)7-3/h3-5H,2H2,1H3,(H,7,8) |
| InChIKey | VZDBAHIONFGMAR-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |