C10H17NO3 — CID 130133529
4-hydroxy-7-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one (PubChem CID 130133529) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-hydroxy-7-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one.
| Compound Name | 4-hydroxy-7-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 130133529 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 4-hydroxy-7-methoxy-3,4,4a,5,6,7,8,8a-octahydro-1H-quinolin-2-one |
| SMILES | COC1CCC2C(O)CC(=O)NC2C1 |
| InChI | InChI=1S/C10H17NO3/c1-14-6-2-3-7-8(4-6)11-10(13)5-9(7)12/h6-9,12H,2-5H2,1H3,(H,11,13) |
| InChIKey | HNWPIVLJHHVJNK-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |