C23H27NO4 — CID 164586192
methyl (2S,6S,9E)-7,14-dioxa-3-azatetracyclo[13.6.2.12,6.018,22]tetracosa-1(22),9,15(23),16,18,20-hexaene-19-carboxylate (PubChem CID 164586192) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is methyl (2S,6S,9E)-7,14-dioxa-3-azatetracyclo[13.6.2.12,6.018,22]tetracosa-1(22),9,15(23),16,18,20-hexaene-19-carboxylate.
| Compound Name | methyl (2S,6S,9E)-7,14-dioxa-3-azatetracyclo[13.6.2.12,6.018,22]tetracosa-1(22),9,15(23),16,18,20-hexaene-19-carboxylate |
|---|---|
| PubChem CID | 164586192 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | methyl (2S,6S,9E)-7,14-dioxa-3-azatetracyclo[13.6.2.12,6.018,22]tetracosa-1(22),9,15(23),16,18,20-hexaene-19-carboxylate |
| SMILES | COC(=O)c1ccc2c3cc(ccc13)OCCC/C=C/CO[C@H]1CCN[C@H]2C1 |
| InChI | InChI=1S/C23H27NO4/c1-26-23(25)20-9-8-19-21-14-16(6-7-18(20)21)27-12-4-2-3-5-13-28-17-10-11-24-22(19)15-17/h3,5-9,14,17,22,24H,2,4,10-13,15H2,1H3/b5-3+/t17-,22-/m0/s1 |
| InChIKey | WBQUJOUEJVSSGS-DIOJSCINSA-N |
| XLogP | 4.16 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|