C18H23NO4 — CID 171604441
methyl (1S,11Z,15S)-8,14-dioxa-18-azatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,11-tetraene-5-carboxylate (PubChem CID 171604441) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl (1S,11Z,15S)-8,14-dioxa-18-azatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,11-tetraene-5-carboxylate.
| Compound Name | methyl (1S,11Z,15S)-8,14-dioxa-18-azatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,11-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 171604441 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl (1S,11Z,15S)-8,14-dioxa-18-azatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,11-tetraene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)OCC/C=C\CO[C@H]1CCN[C@H]2C1 |
| InChI | InChI=1S/C18H23NO4/c1-21-18(20)13-5-6-15-16-12-14(7-8-19-16)22-9-3-2-4-10-23-17(15)11-13/h2-3,5-6,11,14,16,19H,4,7-10,12H2,1H3/b3-2-/t14-,16-/m0/s1 |
| InChIKey | KYDZUWAMZWRASE-PCYIJXPVSA-N |
| XLogP | 2.62 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|