C29H37NO6 — CID 164586396
tert-butyl (2S,4S)-2-(7-but-3-enoxy-4-methoxycarbonylnaphthalen-1-yl)-4-prop-2-enoxypiperidine-1-carboxylate (PubChem CID 164586396) has the molecular formula C29H37NO6 and a molecular weight of 495.62 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-(7-but-3-enoxy-4-methoxycarbonylnaphthalen-1-yl)-4-prop-2-enoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-(7-but-3-enoxy-4-methoxycarbonylnaphthalen-1-yl)-4-prop-2-enoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 164586396 |
| Molecular Formula | C29H37NO6 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | tert-butyl (2S,4S)-2-(7-but-3-enoxy-4-methoxycarbonylnaphthalen-1-yl)-4-prop-2-enoxypiperidine-1-carboxylate |
| SMILES | C=CCCOc1ccc2c(C(=O)OC)ccc([C@@H]3C[C@@H](OCC=C)CCN3C(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C29H37NO6/c1-7-9-17-35-20-10-11-22-24(27(31)33-6)13-12-23(25(22)18-20)26-19-21(34-16-8-2)14-15-30(26)28(32)36-29(3,4)5/h7-8,10-13,18,21,26H,1-2,9,14-17,19H2,3-6H3/t21-,26-/m0/s1 |
| InChIKey | JNGPILKFZAGKLU-LVXARBLLSA-N |
| XLogP | 6.22 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|