C12H6BrCl3N2O — CID 164588869
2-bromo-2-(2-chloropyrimidin-4-yl)-1-(3,4-dichlorophenyl)ethanone (PubChem CID 164588869) has the molecular formula C12H6BrCl3N2O and a molecular weight of 380.46 g/mol. Its IUPAC name is 2-bromo-2-(2-chloropyrimidin-4-yl)-1-(3,4-dichlorophenyl)ethanone.
| Compound Name | 2-bromo-2-(2-chloropyrimidin-4-yl)-1-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 164588869 |
| Molecular Formula | C12H6BrCl3N2O |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 377.87 |
| IUPAC Name | 2-bromo-2-(2-chloropyrimidin-4-yl)-1-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C(Br)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C12H6BrCl3N2O/c13-10(9-3-4-17-12(16)18-9)11(19)6-1-2-7(14)8(15)5-6/h1-5,10H |
| InChIKey | UAIBTRBKUJTVCM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|