C8H10F3N — CID 164590236
(3Z)-N-methyl-4-(trifluoromethyl)hexa-1,3,5-trien-3-amine (PubChem CID 164590236) has the molecular formula C8H10F3N and a molecular weight of 177.17 g/mol. Its IUPAC name is (3Z)-N-methyl-4-(trifluoromethyl)hexa-1,3,5-trien-3-amine.
| Compound Name | (3Z)-N-methyl-4-(trifluoromethyl)hexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 164590236 |
| Molecular Formula | C8H10F3N |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (3Z)-N-methyl-4-(trifluoromethyl)hexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(NC)=C(\C=C)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N/c1-4-6(8(9,10)11)7(5-2)12-3/h4-5,12H,1-2H2,3H3/b7-6- |
| InChIKey | RNBLXYZXDLZANI-SREVYHEPSA-N |
| XLogP | 2.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|