C8H9ClF3N — CID 143206090
(3Z)-5-chloro-N-methyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine (PubChem CID 143206090) has the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. Its IUPAC name is (3Z)-5-chloro-N-methyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-5-chloro-N-methyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143206090 |
| Molecular Formula | C8H9ClF3N |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (3Z)-5-chloro-N-methyl-4-(trifluoromethyl)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C(\C(=C)Cl)C(F)(F)F)NC |
| InChI | InChI=1S/C8H9ClF3N/c1-5(13-3)4-7(6(2)9)8(10,11)12/h4,13H,1-2H2,3H3/b7-4+ |
| InChIKey | FWCLYQLWHJYRON-QPJJXVBHSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|