C10H15F2N — CID 166850149
(1E,3E,5E)-1,7-difluoro-N,3,6-trimethylhepta-1,3,5-trien-4-amine (PubChem CID 166850149) has the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. Its IUPAC name is (1E,3E,5E)-1,7-difluoro-N,3,6-trimethylhepta-1,3,5-trien-4-amine.
| Compound Name | (1E,3E,5E)-1,7-difluoro-N,3,6-trimethylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 166850149 |
| Molecular Formula | C10H15F2N |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (1E,3E,5E)-1,7-difluoro-N,3,6-trimethylhepta-1,3,5-trien-4-amine |
| SMILES | CNC(/C=C(\C)CF)=C(C)/C=C/F |
| InChI | InChI=1S/C10H15F2N/c1-8(7-12)6-10(13-3)9(2)4-5-11/h4-6,13H,7H2,1-3H3/b5-4+,8-6+,10-9+ |
| InChIKey | QROZVJUOMKENMD-OQBIUIKHSA-N |
| XLogP | 2.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|