C10H13ClF3N — CID 143206988
(1E,6Z)-6-chloro-1,8,8-trifluoro-N,7-dimethylocta-1,4,6-trien-2-amine (PubChem CID 143206988) has the molecular formula C10H13ClF3N and a molecular weight of 239.67 g/mol. Its IUPAC name is (1E,6Z)-6-chloro-1,8,8-trifluoro-N,7-dimethylocta-1,4,6-trien-2-amine.
| Compound Name | (1E,6Z)-6-chloro-1,8,8-trifluoro-N,7-dimethylocta-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 143206988 |
| Molecular Formula | C10H13ClF3N |
| Molecular Weight | 239.67 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | (1E,6Z)-6-chloro-1,8,8-trifluoro-N,7-dimethylocta-1,4,6-trien-2-amine |
| SMILES | CN/C(=C/F)CC=C/C(Cl)=C(\C)C(F)F |
| InChI | InChI=1S/C10H13ClF3N/c1-7(10(13)14)9(11)5-3-4-8(6-12)15-2/h3,5-6,10,15H,4H2,1-2H3/b5-3?,8-6+,9-7- |
| InChIKey | WEZKYZJBCPAOHC-ZHFQBCEFSA-N |
| XLogP | 3.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.67 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|