C10H15N3 — CID 164593450
ethane;1-ethylpyrazolo[4,5-b]pyridine (PubChem CID 164593450) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is ethane;1-ethylpyrazolo[4,5-b]pyridine.
| Compound Name | ethane;1-ethylpyrazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 164593450 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | ethane;1-ethylpyrazolo[4,5-b]pyridine |
| SMILES | CC.CCn1ncc2ncccc21 |
| InChI | InChI=1S/C8H9N3.C2H6/c1-2-11-8-4-3-5-9-7(8)6-10-11;1-2/h3-6H,2H2,1H3;1-2H3 |
| InChIKey | XVIILSKAPYUVSD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |