C8H8ClN3 — CID 84718585
7-chloro-1-ethylpyrazolo[4,3-b]pyridine (PubChem CID 84718585) has the molecular formula C8H8ClN3 and a molecular weight of 181.63 g/mol. Its IUPAC name is 7-chloro-1-ethylpyrazolo[4,3-b]pyridine.
| Compound Name | 7-chloro-1-ethylpyrazolo[4,3-b]pyridine |
|---|---|
| PubChem CID | 84718585 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 7-chloro-1-ethylpyrazolo[4,3-b]pyridine |
| SMILES | CCn1ncc2nccc(Cl)c21 |
| InChI | InChI=1S/C8H8ClN3/c1-2-12-8-6(9)3-4-10-7(8)5-11-12/h3-5H,2H2,1H3 |
| InChIKey | DFYXFLPFTYCNPZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |