C24H36O4 — CID 164594945
7-[4-[4-[1-(carboxymethyl)cyclopropyl]butyl]phenyl]-3,3-dimethylheptanoic acid (PubChem CID 164594945) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is 7-[4-[4-[1-(carboxymethyl)cyclopropyl]butyl]phenyl]-3,3-dimethylheptanoic acid.
| Compound Name | 7-[4-[4-[1-(carboxymethyl)cyclopropyl]butyl]phenyl]-3,3-dimethylheptanoic acid |
|---|---|
| PubChem CID | 164594945 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 7-[4-[4-[1-(carboxymethyl)cyclopropyl]butyl]phenyl]-3,3-dimethylheptanoic acid |
| SMILES | CC(C)(CCCCc1ccc(CCCCC2(CC(=O)O)CC2)cc1)CC(=O)O |
| InChI | InChI=1S/C24H36O4/c1-23(2,17-21(25)26)13-5-3-7-19-9-11-20(12-10-19)8-4-6-14-24(15-16-24)18-22(27)28/h9-12H,3-8,13-18H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | CSPCELGIOZCCFK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|