C12H8ClFN4O — CID 164595307
4-[(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-2-fluoroaniline (PubChem CID 164595307) has the molecular formula C12H8ClFN4O and a molecular weight of 278.67 g/mol. Its IUPAC name is 4-[(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-2-fluoroaniline.
| Compound Name | 4-[(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-2-fluoroaniline |
|---|---|
| PubChem CID | 164595307 |
| Molecular Formula | C12H8ClFN4O |
| Molecular Weight | 278.67 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-[(5-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-2-fluoroaniline |
| SMILES | Nc1ccc(Oc2ncnc3[nH]cc(Cl)c23)cc1F |
| InChI | InChI=1S/C12H8ClFN4O/c13-7-4-16-11-10(7)12(18-5-17-11)19-6-1-2-9(15)8(14)3-6/h1-5H,15H2,(H,16,17,18) |
| InChIKey | PXUBDKYEQCTUPK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|