C18H18Cl2N2O — CID 164601785
2-[(2,4-dichlorophenoxy)methyl]-4-(piperidin-4-ylidenemethyl)pyridine (PubChem CID 164601785) has the molecular formula C18H18Cl2N2O and a molecular weight of 349.26 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenoxy)methyl]-4-(piperidin-4-ylidenemethyl)pyridine.
| Compound Name | 2-[(2,4-dichlorophenoxy)methyl]-4-(piperidin-4-ylidenemethyl)pyridine |
|---|---|
| PubChem CID | 164601785 |
| Molecular Formula | C18H18Cl2N2O |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-[(2,4-dichlorophenoxy)methyl]-4-(piperidin-4-ylidenemethyl)pyridine |
| SMILES | Clc1ccc(OCc2cc(C=C3CCNCC3)ccn2)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N2O/c19-15-1-2-18(17(20)11-15)23-12-16-10-14(5-8-22-16)9-13-3-6-21-7-4-13/h1-2,5,8-11,21H,3-4,6-7,12H2 |
| InChIKey | XZGNEQQIFOSDGR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |