C34H40N6O6S — CID 164604532
(5R,8S,9R,12S)-3-(1-benzylpyrazol-4-yl)sulfonyl-N,11,11-trimethyl-6,13-dioxo-9-phenylmethoxy-3,7,14-triazatetracyclo[12.1.1.01,5.010,12]hexadecane-8-carboxamide (PubChem CID 164604532) has the molecular formula C34H40N6O6S and a molecular weight of 660.80 g/mol. Its IUPAC name is (5R,8S,9R,12S)-3-(1-benzylpyrazol-4-yl)sulfonyl-N,11,11-trimethyl-6,13-dioxo-9-phenylmethoxy-3,7,14-triazatetracyclo[12.1.1.01,5.010,12]hexadecane-8-carboxamide.
| Compound Name | (5R,8S,9R,12S)-3-(1-benzylpyrazol-4-yl)sulfonyl-N,11,11-trimethyl-6,13-dioxo-9-phenylmethoxy-3,7,14-triazatetracyclo[12.1.1.01,5.010,12]hexadecane-8-carboxamide |
|---|---|
| PubChem CID | 164604532 |
| Molecular Formula | C34H40N6O6S |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.27 |
| IUPAC Name | (5R,8S,9R,12S)-3-(1-benzylpyrazol-4-yl)sulfonyl-N,11,11-trimethyl-6,13-dioxo-9-phenylmethoxy-3,7,14-triazatetracyclo[12.1.1.01,5.010,12]hexadecane-8-carboxamide |
| SMILES | CNC(=O)[C@H]1NC(=O)[C@H]2CN(S(=O)(=O)c3cnn(Cc4ccccc4)c3)CC23CN(C3)C(=O)[C@H]2C([C@H]1OCc1ccccc1)C2(C)C |
| InChI | InChI=1S/C34H40N6O6S/c1-33(2)26-27(33)32(43)38-19-34(20-38)21-40(47(44,45)24-14-36-39(16-24)15-22-10-6-4-7-11-22)17-25(34)30(41)37-28(31(42)35-3)29(26)46-18-23-12-8-5-9-13-23/h4-14,16,25-29H,15,17-21H2,1-3H3,(H,35,42)(H,37,41)/t25-,26?,27-,28+,29-/m1/s1 |
| InChIKey | QYMOIHIZMYGHSE-BYLMQZBQSA-N |
| XLogP | 1.48 |
| TPSA | 142.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |