C30H56N6O5S — CID 164609994
(2S)-5-(diaminomethylideneamino)-2-[[2-[[(2R)-2-[[(E)-nonadec-9-enoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]pentanoic acid (PubChem CID 164609994) has the molecular formula C30H56N6O5S and a molecular weight of 612.88 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2R)-2-[[(E)-nonadec-9-enoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2R)-2-[[(E)-nonadec-9-enoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 164609994 |
| Molecular Formula | C30H56N6O5S |
| Molecular Weight | 612.88 g/mol |
| Exact Mass | 612.40 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2R)-2-[[(E)-nonadec-9-enoyl]amino]-3-sulfanylpropanoyl]amino]acetyl]amino]pentanoic acid |
| SMILES | CCCCCCCCC/C=C/CCCCCCCC(=O)N[C@@H](CS)C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C30H56N6O5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-26(37)36-25(23-42)28(39)34-22-27(38)35-24(29(40)41)19-18-21-33-30(31)32/h10-11,24-25,42H,2-9,12-23H2,1H3,(H,34,39)(H,35,38)(H,36,37)(H,40,41)(H4,31,32,33)/b11-10+/t24-,25-/m0/s1 |
| InChIKey | UZZUAFVZKKJSSL-VEJRGLATSA-N |
| XLogP | 3.57 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.88 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|