C23H40N4O3 — CID 171116601
(2S)-4-(diaminomethylideneamino)-2-[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]amino]butanoic acid (PubChem CID 171116601) has the molecular formula C23H40N4O3 and a molecular weight of 420.60 g/mol. Its IUPAC name is (2S)-4-(diaminomethylideneamino)-2-[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]amino]butanoic acid.
| Compound Name | (2S)-4-(diaminomethylideneamino)-2-[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 171116601 |
| Molecular Formula | C23H40N4O3 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | (2S)-4-(diaminomethylideneamino)-2-[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]amino]butanoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)N[C@@H](CCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H40N4O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(28)27-20(22(29)30)18-19-26-23(24)25/h6-7,9-10,12-13,20H,2-5,8,11,14-19H2,1H3,(H,27,28)(H,29,30)(H4,24,25,26)/b7-6-,10-9-,13-12-/t20-/m0/s1 |
| InChIKey | XUULXRIWGWMCQS-FFXVNFNPSA-N |
| XLogP | 3.81 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|